Difference between revisions of "RXN-7647"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * smiles: ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3...")
(Created page with "Category:Gene == Gene Tiso_gene_4269 == * left end position: ** 13119 * transcription direction: ** POSITIVE * right end position: ** 14143 * centisome position: ** 86.806...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
+
== Gene Tiso_gene_4269 ==
* smiles:
+
* left end position:
** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
+
** 13119
* inchi key:
+
* transcription direction:
** InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
+
** POSITIVE
* common name:
+
* right end position:
** mycophenolic acid O-acyl-glucuronide
+
** 14143
* molecular weight:
+
* centisome position:
** 495.459    
+
** 86.80606    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[SAMDECARB-RXN]]
* [[RXN-13607]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[BSUBPOLYAMSYN-PWY]]
 +
* [[ARGSPECAT-PWY]]
 +
* [[PWY-6834]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=13119}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678773 70678773]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=14143}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66982 66982]
+
{{#set: centisome position=86.80606    }}
{{#set: smiles=CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)}}
+
{{#set: reaction associated=SAMDECARB-RXN}}
{{#set: inchi key=InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M}}
+
{{#set: pathway associated=BSUBPOLYAMSYN-PWY|ARGSPECAT-PWY|PWY-6834}}
{{#set: common name=mycophenolic acid O-acyl-glucuronide}}
+
{{#set: molecular weight=495.459    }}
+
{{#set: produced by=RXN-13607}}
+

Revision as of 18:41, 18 March 2018

Gene Tiso_gene_4269

  • left end position:
    • 13119
  • transcription direction:
    • POSITIVE
  • right end position:
    • 14143
  • centisome position:
    • 86.80606
  • Synonym(s):

Reactions associated

Pathways associated

External links