Difference between revisions of "RXN-6201"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)[N+])[N+] * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.58-RXN 2.5.1.58-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.58-RXN 2.5.1.58-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.58 EC-2.5.1.58] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[FARNESYL-PP]][c] '''+''' 1 [[PROT-CYS]][c] '''<=>''' 1 [[PPI]][c] '''+''' 1 [[Protein-S-farnesyl-L-cysteines]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 (2E,6E)-farnesyl diphosphate[c] '''+''' 1 a [protein]-L-cysteine[c] '''<=>''' 1 diphosphate[c] '''+''' 1 a [protein] S-farnesyl-L-cysteine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_19356]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: ec number=EC-2.5.1.58}} | |
− | + | {{#set: gene associated=Tiso_gene_19356}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:41, 18 March 2018
Contents
Reaction 2.5.1.58-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 FARNESYL-PP[c] + 1 PROT-CYS[c] <=> 1 PPI[c] + 1 Protein-S-farnesyl-L-cysteines[c]
- With common name(s):
- 1 (2E,6E)-farnesyl diphosphate[c] + 1 a [protein]-L-cysteine[c] <=> 1 diphosphate[c] + 1 a [protein] S-farnesyl-L-cysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus