Difference between revisions of "Tiso gene 17333"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquinones Ubiquinones] == * common name: ** a ubiquinone * Synonym(s): ** coenzyme-Qn ** ubiq...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquinones Ubiquinones] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a ubiquinone |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** coenzyme-Qn | ||
| + | ** ubiquinone | ||
| + | ** Q | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN0-5330]] |
| + | * [[RXN0-5260]] | ||
| + | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]] | ||
| + | * [[RXN0-6491]] | ||
| + | * [[RXN-15829]] | ||
| + | * [[RXN0-5244]] | ||
| + | * [[RXN0-7008]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-6883]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[1. | + | * [[1.10.2.2-RXN]] |
| − | * [[RXN- | + | * [[NADH-DEHYDROG-A-RXN]] |
| + | * [[1.5.5.1-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a ubiquinone}} | |
| − | + | {{#set: common name=coenzyme-Qn|ubiquinone|Q}} | |
| − | + | {{#set: consumed by=RXN0-5330|RXN0-5260|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN|RXN0-6491|RXN-15829|RXN0-5244|RXN0-7008}} | |
| − | + | {{#set: produced by=RXN-6883}} | |
| − | {{#set: | + | {{#set: reversible reaction associated=1.10.2.2-RXN|NADH-DEHYDROG-A-RXN|1.5.5.1-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 18:42, 18 March 2018
Contents
Metabolite Ubiquinones
- common name:
- a ubiquinone
- Synonym(s):
- coenzyme-Qn
- ubiquinone
- Q
