Difference between revisions of "CPD-9925"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-hydroxyacyl-glutathiones 2-hydroxyacyl-glutathiones] == * common name: ** S-(2-hydroxyacyl)gl...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] == |
| + | * smiles: | ||
| + | ** C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** GDP-α-D-mannose |
| + | * molecular weight: | ||
| + | ** 603.329 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** guanosine pyrophosphate mannose | ||
| + | ** guanosine diphosphomannose | ||
| + | ** guanosine diphosphate mannose | ||
| + | ** GDP-mannose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-5464]] |
| + | * [[GDPMANDEHYDRA-RXN]] | ||
| + | * [[RXN-5462]] | ||
| + | * [[RXN-5463]] | ||
| + | * [[2.4.1.83-RXN]] | ||
| + | * [[2.4.1.142-RXN]] | ||
| + | * [[RXN-16602]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.7.7.13-RXN]] | ||
| + | * [[GAMPG]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.4.1.232-RXN]] | ||
| + | * [[2.4.1.32-RXN]] | ||
| + | * [[RXN-1882]] | ||
| + | * [[RXN-7771]] | ||
| + | * [[MANNPGUANYLTRANGDP-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 18441-12-8 |
| − | {{#set: consumed by=RXN- | + | * CAS : 3123-67-9 |
| + | * METABOLIGHTS : MTBLC57527 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878389 46878389] | ||
| + | * HMDB : HMDB01163 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00096 C00096] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57527 57527] | ||
| + | * BIGG : gdpmann | ||
| + | {{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))}} | ||
| + | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L}} | ||
| + | {{#set: common name=GDP-α-D-mannose}} | ||
| + | {{#set: molecular weight=603.329 }} | ||
| + | {{#set: common name=guanosine pyrophosphate mannose|guanosine diphosphomannose|guanosine diphosphate mannose|GDP-mannose}} | ||
| + | {{#set: consumed by=RXN-5464|GDPMANDEHYDRA-RXN|RXN-5462|RXN-5463|2.4.1.83-RXN|2.4.1.142-RXN|RXN-16602}} | ||
| + | {{#set: produced by=2.7.7.13-RXN|GAMPG}} | ||
| + | {{#set: reversible reaction associated=2.4.1.232-RXN|2.4.1.32-RXN|RXN-1882|RXN-7771|MANNPGUANYLTRANGDP-RXN}} | ||
Revision as of 18:42, 18 March 2018
Contents
Metabolite GDP-MANNOSE
- smiles:
- C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))
- inchi key:
- InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L
- common name:
- GDP-α-D-mannose
- molecular weight:
- 603.329
- Synonym(s):
- guanosine pyrophosphate mannose
- guanosine diphosphomannose
- guanosine diphosphate mannose
- GDP-mannose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 18441-12-8
- CAS : 3123-67-9
- METABOLIGHTS : MTBLC57527
- PUBCHEM:
- HMDB : HMDB01163
- LIGAND-CPD:
- CHEBI:
- BIGG : gdpmann
"C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))" cannot be used as a page name in this wiki.
