Difference between revisions of "Carboxylates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Secondary-Alcohols Secondary-Alcohols] == * common name: ** a secondary alcohol * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * i...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == |
| + | * smiles: | ||
| + | ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** cis-homoaconitate |
| + | * molecular weight: | ||
| + | ** 185.113 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-carboxyhex-2-enedioate | ||
| + | ** (Z)-but-1-ene-1,2,4-tricarboxylate | ||
| + | ** homo-cis-aconitate | ||
| + | ** (Z)-1,2,4-but-1-enetricarboxylic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21158450 21158450] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.20117984.html 20117984] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58174 58174] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04002 C04002] | ||
| + | {{#set: smiles=C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K}} | ||
| + | {{#set: common name=cis-homoaconitate}} | ||
| + | {{#set: molecular weight=185.113 }} | ||
| + | {{#set: common name=3-carboxyhex-2-enedioate|(Z)-but-1-ene-1,2,4-tricarboxylate|homo-cis-aconitate|(Z)-1,2,4-but-1-enetricarboxylic acid}} | ||
| + | {{#set: reversible reaction associated=HOMOACONITATE-HYDRATASE-RXN}} | ||
Revision as of 18:43, 18 March 2018
Contents
Metabolite HOMO-CIS-ACONITATE
- smiles:
- C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-]
- inchi key:
- InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K
- common name:
- cis-homoaconitate
- molecular weight:
- 185.113
- Synonym(s):
- 3-carboxyhex-2-enedioate
- (Z)-but-1-ene-1,2,4-tricarboxylate
- homo-cis-aconitate
- (Z)-1,2,4-but-1-enetricarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-" cannot be used as a page name in this wiki.
