Difference between revisions of "Tiso gene 4156"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...")
(Created page with "Category:Gene == Gene Tiso_gene_565 == * left end position: ** 4555 * transcription direction: ** POSITIVE * right end position: ** 5955 * centisome position: ** 14.475022...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] ==
+
== Gene Tiso_gene_565 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
+
** 4555
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** β-D-fructofuranose 1-phosphate
+
** 5955
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 14.475022    
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-fructofuranose-1-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8631]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[KETOHEXOKINASE-RXN]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 15978-08-2
+
{{#set: left end position=4555}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216]
+
{{#set: right end position=5955}}
−
* BIGG : f1p
+
{{#set: centisome position=14.475022   }}
−
{{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}}
+
−
{{#set: common name=β-D-fructofuranose 1-phosphate}}
+
−
{{#set: molecular weight=258.121   }}
+
−
{{#set: common name=β-D-fructofuranose-1-P}}
+
−
{{#set: consumed by=RXN-8631}}
+
−
{{#set: produced by=KETOHEXOKINASE-RXN}}
+

Revision as of 18:43, 18 March 2018

Gene Tiso_gene_565

  • left end position:
    • 4555
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5955
  • centisome position:
    • 14.475022
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4156&oldid=26376"