Difference between revisions of "Tiso gene 14881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] ==
−
* smiles:
+
* direction:
−
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L
+
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
−
* common name:
+
−
** dTDP-β-L-rhamnose
+
−
* molecular weight:
+
−
** 546.317   
+
 
* Synonym(s):
 
* Synonym(s):
−
** dTDP-6-deoxy-β-L-mannose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NICOTINE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-3187]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 (S)-nicotine[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 2'-hydroxynicotine[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_1035]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-201]], nicotine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-201 PWY66-201]
 +
** '''3''' reactions found over '''17''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 572-96-3
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.14.14.1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245982 25245982]
+
{{#set: gene associated=Tiso_gene_1035}}
−
* HMDB : HMDB06354
+
{{#set: in pathway=PWY66-201}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03319 C03319]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57510 57510]
+
−
* BIGG : dtdprmn
+
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))}}
+
−
{{#set: inchi key=InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L}}
+
−
{{#set: common name=dTDP-β-L-rhamnose}}
+
−
{{#set: molecular weight=546.317    }}
+
−
{{#set: common name=dTDP-6-deoxy-β-L-mannose}}
+
−
{{#set: produced by=DTDPDEHYRHAMREDUCT-RXN}}
+

Revision as of 18:43, 18 March 2018

Reaction RXN66-146

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-201, nicotine degradation IV: PWY66-201
    • 3 reactions found over 17 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14881&oldid=26428"