Difference between revisions of "Tiso gene 14583"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] == * smiles: ** C(O)C1(OC(=O)C(O)C(O)1) * inchi key: ** InChIKey=CUOKHACJLGPRH...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(O)C1(OC(=O)C(O)C(O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N |
* common name: | * common name: | ||
− | ** | + | ** D-arabinono-1,4-lactone |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 148.115 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[1.1.3.37-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=17723 17723] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.16751.html 16751] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16292 16292] |
− | {{#set: smiles=C( | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00652 C00652] |
− | {{#set: common name= | + | {{#set: smiles=C(O)C1(OC(=O)C(O)C(O)1)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N}} |
− | {{#set: | + | {{#set: common name=D-arabinono-1,4-lactone}} |
− | + | {{#set: molecular weight=148.115 }} | |
− | + | {{#set: consumed by=1.1.3.37-RXN}} |
Revision as of 18:44, 18 March 2018
Contents
Metabolite CPD-356
- smiles:
- C(O)C1(OC(=O)C(O)C(O)1)
- inchi key:
- InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
- common name:
- D-arabinono-1,4-lactone
- molecular weight:
- 148.115
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links