Difference between revisions of "2.1.1.109-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_17143 == * left end position: ** 21 * transcription direction: ** POSITIVE * right end position: ** 3149 * centisome position: ** 0.5399846...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17143 == |
− | * | + | * left end position: |
− | ** | + | ** 21 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3149 |
− | * | + | * centisome position: |
− | ** | + | ** 0.5399846 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-12086]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | * [[ | + | * [[RXN-12579]] |
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[TRIACYLGLYCEROL-LIPASE-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[LIPAS-PWY]] | ||
+ | * [[PWY-6857]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=21}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3149}} | |
− | + | {{#set: centisome position=0.5399846 }} | |
− | + | {{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}} | |
− | + | {{#set: pathway associated=LIPAS-PWY|PWY-6857}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:45, 18 March 2018
Gene Tiso_gene_17143
- left end position:
- 21
- transcription direction:
- POSITIVE
- right end position:
- 3149
- centisome position:
- 0.5399846
- Synonym(s):
Reactions associated
- RXN-12086
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-12579
- in-silico_annotation
- ec-number
- in-silico_annotation
- TRIACYLGLYCEROL-LIPASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation