Difference between revisions of "PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-334 CPD-334] == * smiles: ** C(C(C(C(C(C([O-])=O)=O)=O)O)O)O * inchi key: ** InChIKey=GJQWC...") |
(Created page with "Category:Gene == Gene Tiso_gene_16842 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** pantograph...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_16842 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * [[1.14.11.2-RXN]] |
| − | + | ** [[pantograph]]-[[esiliculosus]] | |
| − | * [[ | + | * [[RXN490-3641]] |
| − | == | + | ** [[pantograph]]-[[esiliculosus]] |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 18:45, 18 March 2018
Gene Tiso_gene_16842
- Synonym(s):
