Difference between revisions of "Tiso gene 2159"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14809 RXN-14809] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == * smiles: ** CCC(C)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AGPKZVBTJJNPAG-WHFBIAK...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == |
− | * | + | * smiles: |
− | ** | + | ** CCC(C)C([N+])C(=O)[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N | ||
+ | * common name: | ||
+ | ** L-isoleucine | ||
+ | * molecular weight: | ||
+ | ** 131.174 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** I | ||
+ | ** ile | ||
+ | ** iso-leucine | ||
+ | ** L-ile | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[ISOLEUCINE--TRNA-LIGASE-RXN]] | |
− | + | * [[RME144]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 73-32-5 |
− | {{#set: | + | * METABOLIGHTS : MTBLC58045 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7043901 7043901] |
− | {{#set: | + | * HMDB : HMDB00172 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00407 C00407] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58045 58045] | ||
+ | * BIGG : ile__L | ||
+ | {{#set: smiles=CCC(C)C([N+])C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N}} | ||
+ | {{#set: common name=L-isoleucine}} | ||
+ | {{#set: molecular weight=131.174 }} | ||
+ | {{#set: common name=I|ile|iso-leucine|L-ile}} | ||
+ | {{#set: consumed by=ISOLEUCINE--TRNA-LIGASE-RXN|RME144}} | ||
+ | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERILEU-RXN}} |
Revision as of 18:45, 18 March 2018
Contents
Metabolite ILE
- smiles:
- CCC(C)C([N+])C(=O)[O-]
- inchi key:
- InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N
- common name:
- L-isoleucine
- molecular weight:
- 131.174
- Synonym(s):
- I
- ile
- iso-leucine
- L-ile
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73-32-5
- METABOLIGHTS : MTBLC58045
- PUBCHEM:
- HMDB : HMDB00172
- LIGAND-CPD:
- CHEBI:
- BIGG : ile__L
"CCC(C)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.