Difference between revisions of "PGCM"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * inchi key: ** InChIKey=KWOLFJPFCHCOCG-UHFF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N |
* common name: | * common name: | ||
| − | ** | + | ** monodehydroascorbate radical |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 175.118 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** monodehydroascorbic acid |
| − | ** | + | ** semidehydroascorbic acid |
| + | ** semidehydroascorbate | ||
| + | ** ascorbyl radical | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-3523]] | ||
| + | * [[1.6.5.4-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10981]] | ||
| + | * [[RXN-3521]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504] |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041] |
| − | {{#set: common name= | + | {{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=monodehydroascorbate radical}} |
| − | {{#set: consumed | + | {{#set: molecular weight=175.118 }} |
| + | {{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}} | ||
| + | {{#set: consumed by=RXN-3523|1.6.5.4-RXN}} | ||
| + | {{#set: produced by=RXN-10981|RXN-3521}} | ||
Revision as of 18:46, 18 March 2018
Contents
Metabolite CPD-318
- smiles:
- C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
- inchi key:
- InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
- common name:
- monodehydroascorbate radical
- molecular weight:
- 175.118
- Synonym(s):
- monodehydroascorbic acid
- semidehydroascorbic acid
- semidehydroascorbate
- ascorbyl radical
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)" cannot be used as a page name in this wiki.
