Difference between revisions of "CPD-8343"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == * smiles: ** C(#N)CCC1(C=CC=CC=1) * inchi key: ** InChIKey=ACRWYXSKEHUQ...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13306 RXN-13306] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13306 RXN-13306] ==
* smiles:
+
* direction:
** C(#N)CCC1(C=CC=CC=1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/1.3.1.93 EC-1.3.1.93]
* common name:
+
** 3-phenylpropionitrile
+
* molecular weight:
+
** 131.177   
+
 
* Synonym(s):
 
* Synonym(s):
** benzenepropanenitrile
 
** 2-phenylethyl cyanide
 
** 3-phenylpropanonitril
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-18229]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-14280]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-9965]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 trans-arachido-2-enoyl-CoA[c] '''=>''' 1 NADP+[c] '''+''' 1 icosanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
 +
** '''16''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12581 12581]
+
{{#set: ec number=EC-1.3.1.93}}
* CHEMSPIDER:
+
{{#set: in pathway=PWY-7036}}
** [http://www.chemspider.com/Chemical-Structure.12061.html 12061]
+
{{#set: reconstruction category=annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85426 85426]
+
{{#set: reconstruction tool=pathwaytools}}
* HMDB : HMDB34236
+
{{#set: smiles=C(#N)CCC1(C=CC=CC=1)}}
+
{{#set: inchi key=InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N}}
+
{{#set: common name=3-phenylpropionitrile}}
+
{{#set: molecular weight=131.177    }}
+
{{#set: common name=benzenepropanenitrile|2-phenylethyl cyanide|3-phenylpropanonitril}}
+
{{#set: consumed by=RXN-18229}}
+

Revision as of 18:46, 18 March 2018

Reaction RXN-13306

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADPH[c] + 1 H+[c] + 1 trans-arachido-2-enoyl-CoA[c] => 1 NADP+[c] + 1 icosanoyl-CoA[c]

Genes associated with this reaction

Pathways

  • PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
    • 16 reactions found over 16 reactions in the full pathway

Reconstruction information

External links