Difference between revisions of "CPD-13910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octanoylated-domains Octanoylated-domains] == * common name: ** a [lipoyl-carrier protein] N6-o...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octanoylated-domains Octanoylated-domains] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] ==
 +
* smiles:
 +
** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
 +
* inchi key:
 +
** InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
 
* common name:
 
* common name:
** a [lipoyl-carrier protein] N6-octanoyl-L-lysine
+
** cyclic- 3,4-O-oxalyl-L-threonate
 +
* molecular weight:
 +
** 189.101   
 
* Synonym(s):
 
* Synonym(s):
** an octanoylated protein lipoyl-domain
+
** 3,4-cyclic oxalyl theronolactone
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-949]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-947]]
+
* [[RXN-12872]]
* [[RXN0-5098]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a [lipoyl-carrier protein] N6-octanoyl-L-lysine}}
+
* PUBCHEM:
{{#set: common name=an octanoylated protein lipoyl-domain}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658084 90658084]
{{#set: consumed by=RXN0-949}}
+
{{#set: smiles=C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)}}
{{#set: produced by=RXN0-947|RXN0-5098}}
+
{{#set: inchi key=InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M}}
 +
{{#set: common name=cyclic- 3,4-O-oxalyl-L-threonate}}
 +
{{#set: molecular weight=189.101    }}
 +
{{#set: common name=3,4-cyclic oxalyl theronolactone}}
 +
{{#set: produced by=RXN-12872}}

Revision as of 18:47, 18 March 2018

Metabolite CPD-13910

  • smiles:
    • C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
  • inchi key:
    • InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
  • common name:
    • cyclic- 3,4-O-oxalyl-L-threonate
  • molecular weight:
    • 189.101
  • Synonym(s):
    • 3,4-cyclic oxalyl theronolactone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)" cannot be used as a page name in this wiki.