Difference between revisions of "Tiso gene 18788"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADEC ADEC] == * direction: ** LEFT-TO-RIGHT * common name: ** adenylate cyclase * Synonym(s): == R...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * inchi key: **...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADEC ADEC] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C2(=C(C1(C=CC=CC=1N2))C(O)CO)
 +
* inchi key:
 +
** InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** adenylate cyclase
+
** indole-3-glycol
 +
* molecular weight:
 +
** 177.202   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[ATP]][c] '''=>''' 1.0 [[CAMP]][c] '''+''' 1.0 [[PPI]][c]
+
* [[RXN-5424]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 ATP[c] '''=>''' 1.0 cyclic-AMP[c] '''+''' 1.0 diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10495]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_34]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_8950]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_16143]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=adenylate cyclase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202910 25202910]
−
{{#set: gene associated=Tiso_gene_10495|Tiso_gene_34|Tiso_gene_8950|Tiso_gene_16143}}
+
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)CO)}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=indole-3-glycol}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=177.202    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: produced by=RXN-5424}}

Revision as of 18:47, 18 March 2018

Metabolite INDOLE-3-GLYCOL

  • smiles:
    • C2(=C(C1(C=CC=CC=1N2))C(O)CO)
  • inchi key:
    • InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
  • common name:
    • indole-3-glycol
  • molecular weight:
    • 177.202
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18788&oldid=26796"