Difference between revisions of "Beta-D-Galactosides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Polyphosphate Long-Chain-Polyphosphate] == * common name: ** long chain polyphosphat...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Polyphosphate Long-Chain-Polyphosphate] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** long chain polyphosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (phosphate)(n) |
| + | ** (phosphate)(n+1) | ||
| + | ** (phosphate)(n-1) | ||
| + | ** (polyphosphate)(n) | ||
| + | ** (polyphosphate)(n+1) | ||
| + | ** (polyphosphate)(n-1) | ||
| + | ** PolyP | ||
| + | ** inorganic polyphosphate | ||
| + | ** (polyphosphate)(n-2) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[EXOPOLYPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[EXOPOLYPHOSPHATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=long chain polyphosphate}} | |
| − | + | {{#set: common name=(phosphate)(n)|(phosphate)(n+1)|(phosphate)(n-1)|(polyphosphate)(n)|(polyphosphate)(n+1)|(polyphosphate)(n-1)|PolyP|inorganic polyphosphate|(polyphosphate)(n-2)}} | |
| − | {{#set: | + | {{#set: consumed by=EXOPOLYPHOSPHATASE-RXN}} |
| − | + | {{#set: produced by=EXOPOLYPHOSPHATASE-RXN}} | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: produced by=RXN | + | |
Revision as of 18:47, 18 March 2018
Contents
Metabolite Long-Chain-Polyphosphate
- common name:
- long chain polyphosphate
- Synonym(s):
- (phosphate)(n)
- (phosphate)(n+1)
- (phosphate)(n-1)
- (polyphosphate)(n)
- (polyphosphate)(n+1)
- (polyphosphate)(n-1)
- PolyP
- inorganic polyphosphate
- (polyphosphate)(n-2)
