Difference between revisions of "GLUTAMATE-SYNTHASE-NADH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18082 RXN-18082] == * direction: ** LEFT-TO-RIGHT * common name: ** beta-hexosaminidase * ec nu...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18082 RXN-18082] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
 +
* inchi key:
 +
** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
 
* common name:
 
* common name:
−
** beta-hexosaminidase
+
** pppGpp
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.2.1.52 EC-3.2.1.52]
+
** 677.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** guanosine pentaphosphate
 +
** guanosine 3'-diphosphate 5'-triphosphate
 +
** guanosine 5'-triphosphate,3'-diphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-6427]]
−
** 1 [[CHITIN]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[N-acetyl-D-glucosamine]][c] '''+''' 1 [[CHITIN]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[GTPPYPHOSKIN-RXN]]
−
** 1 chitin[c] '''+''' 1 H2O[c] '''=>''' 1 N-acetyl-D-glucosamine[c] '''+''' 1 chitin[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14122]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_1129]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=beta-hexosaminidase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494]
−
{{#set: ec number=EC-3.2.1.52}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_14122|Tiso_gene_1129}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690]
−
{{#set: in pathway=}}
+
* BIGG : gdptp
−
{{#set: reconstruction category=annotation}}
+
* PUBCHEM:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549]
−
{{#set: reconstruction source=in-silico_annotation}}
+
* HMDB : HMDB60480
 +
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
 +
{{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}}
 +
{{#set: common name=pppGpp}}
 +
{{#set: molecular weight=677.095    }}
 +
{{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}}
 +
{{#set: consumed by=RXN0-6427}}
 +
{{#set: produced by=GTPPYPHOSKIN-RXN}}

Revision as of 18:47, 18 March 2018

Metabolite GDP-TP

  • smiles:
    • C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
  • common name:
    • pppGpp
  • molecular weight:
    • 677.095
  • Synonym(s):
    • guanosine pentaphosphate
    • guanosine 3'-diphosphate 5'-triphosphate
    • guanosine 5'-triphosphate,3'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLUTAMATE-SYNTHASE-NADH-RXN&oldid=26883"