Difference between revisions of "Tiso gene 3487"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.19-RXN 1.5.1.19-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.19-RXN 1.5.1.19-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.5.1.19 EC-1.5.1.19]
+
** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
 +
* common name:
 +
** (7Z)-tetradecenoyl-CoA
 +
* molecular weight:
 +
** 971.845   
 
* Synonym(s):
 
* Synonym(s):
 +
** 14:1-Δ7-CoA
 +
** cis-7-tetradecenoyl-CoA
 +
** 14:1(n-7)-CoA
 +
** (7Z)-tetradec-7-enoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17792]]
−
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[ARG]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[CPD-308]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-17791]]
−
** 1 2-oxoglutarate[c] '''+''' 1 L-arginine[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 D-nopaline[c] '''+''' 1 NADP+[c] '''+''' 1 H2O[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8893]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
{{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19637 19637]
+
{{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}}
−
* LIGAND-RXN:
+
{{#set: common name=(7Z)-tetradecenoyl-CoA}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00563 R00563]
+
{{#set: molecular weight=971.845    }}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}}
−
{{#set: ec number=EC-1.5.1.19}}
+
{{#set: consumed by=RXN-17792}}
−
{{#set: gene associated=Tiso_gene_8893}}
+
{{#set: produced by=RXN-17791}}
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+

Revision as of 18:48, 18 March 2018

Metabolite CPD-19147

  • smiles:
    • CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
  • common name:
    • (7Z)-tetradecenoyl-CoA
  • molecular weight:
    • 971.845
  • Synonym(s):
    • 14:1-Δ7-CoA
    • cis-7-tetradecenoyl-CoA
    • 14:1(n-7)-CoA
    • (7Z)-tetradec-7-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3487&oldid=26928"