Difference between revisions of "TRNA-fragment"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Palmitoleoyl-ACPs Palmitoleoyl-ACPs] == * common name: ** a palmitoleoyl-[acp] * Synonym(s): **...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Palmitoleoyl-ACPs Palmitoleoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a palmitoleoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a (Z)-hexadec-9-enoyl-[acp] |
| − | + | ** a (Z)-hexadec-9-enoyl-[acyl-carrier-protein] | |
| − | ** | + | ** a cis-hexadec-9-enoyl-[acp] |
| − | ** | + | ** a cis-hexadec-9-enoyl-[acyl-carrier-protein] |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17020]] |
| − | * [[RXN- | + | * [[2.3.1.179-RXN]] |
| + | * [[RXN-17013]] | ||
| + | * [[RXN-17012]] | ||
| + | * [[RXN-9550]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8389]] |
| + | * [[RXN-10661]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a palmitoleoyl-[acp]}} | |
| − | + | {{#set: common name=a (Z)-hexadec-9-enoyl-[acp]|a (Z)-hexadec-9-enoyl-[acyl-carrier-protein]|a cis-hexadec-9-enoyl-[acp]|a cis-hexadec-9-enoyl-[acyl-carrier-protein]}} | |
| − | + | {{#set: consumed by=RXN-17020|2.3.1.179-RXN|RXN-17013|RXN-17012|RXN-9550}} | |
| − | + | {{#set: produced by=RXN-8389|RXN-10661}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: consumed by=RXN- | + | |
| − | {{#set: produced by=RXN- | + | |
Revision as of 18:48, 18 March 2018
Contents
Metabolite Palmitoleoyl-ACPs
- common name:
- a palmitoleoyl-[acp]
- Synonym(s):
- a (Z)-hexadec-9-enoyl-[acp]
- a (Z)-hexadec-9-enoyl-[acyl-carrier-protein]
- a cis-hexadec-9-enoyl-[acp]
- a cis-hexadec-9-enoyl-[acyl-carrier-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a palmitoleoyl-[acp" cannot be used as a page name in this wiki.
- "a (Z)-hexadec-9-enoyl-[acp" cannot be used as a page name in this wiki.
- "a (Z)-hexadec-9-enoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
- "a cis-hexadec-9-enoyl-[acp" cannot be used as a page name in this wiki.
- "a cis-hexadec-9-enoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
