Difference between revisions of "Tiso gene 11756"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19510 == * left end position: ** 551 * transcription direction: ** NEGATIVE * right end position: ** 1900 * centisome position: ** 24.39132...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N |
− | * | + | * common name: |
− | ** | + | ** reduced riboflavin |
− | * | + | * molecular weight: |
− | ** | + | ** 378.384 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4a,5-dihydroriboflavine | ||
+ | ** 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine | ||
+ | ** 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-12445]] |
− | + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480537 45480537] |
− | {{#set: | + | * HMDB : HMDB01557 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01007 C01007] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.52885.html 52885] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8798 8798] | ||
+ | * BIGG : rbflvrd | ||
+ | {{#set: smiles=CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)}} | ||
+ | {{#set: inchi key=InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N}} | ||
+ | {{#set: common name=reduced riboflavin}} | ||
+ | {{#set: molecular weight=378.384 }} | ||
+ | {{#set: common name=4a,5-dihydroriboflavine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione}} | ||
+ | {{#set: produced by=RXN-12445|NADPH-DEHYDROGENASE-FLAVIN-RXN}} |
Revision as of 18:48, 18 March 2018
Contents
Metabolite CPD-316
- smiles:
- CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)
- inchi key:
- InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N
- common name:
- reduced riboflavin
- molecular weight:
- 378.384
- Synonym(s):
- 4a,5-dihydroriboflavine
- 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine
- 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione" cannot be used as a page name in this wiki.