Difference between revisions of "RXN-11521"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * smiles: ** CC(O)(C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=XFTRTWQBIOMV...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15587 RXN-15587] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15587 RXN-15587] ==
−
* smiles:
+
* direction:
−
** CC(O)(C(=O)[O-])CC(=O)[O-]
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L
+
** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1]
−
* common name:
+
−
** (R)-citramalate
+
−
* molecular weight:
+
−
** 146.099   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-2-methylmalic acid
 
−
** (3R)-citramalate
 
−
** (3R)-citramalic acid
 
−
** (3R)-α-hydroxypyrotartaric acid
 
−
** D-citramalate
 
−
** D-citramalic acid
 
−
** D-α-hydroxypyrotartaric acid
 
−
** (R)-2-methylmalate
 
−
** (R)-(-)-citramalic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-7743]]
+
** 1 [[INDOXYL]][c] '''+''' 1 [[PAPS]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c] '''+''' 1 [[CPD-16817]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 indoxyl[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''<=>''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 indoxyl sulfate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_5505]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6236-10-8
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: ec number=EC-2.8.2.1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460281 5460281]
+
{{#set: gene associated=Tiso_gene_5505}}
−
* CHEMSPIDER:
+
{{#set: in pathway=}}
−
** [http://www.chemspider.com/Chemical-Structure.4573870.html 4573870]
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30934 30934]
+
{{#set: reconstruction tool=pantograph}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02612 C02612]
+
−
{{#set: smiles=CC(O)(C(=O)[O-])CC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L}}
+
−
{{#set: common name=(R)-citramalate}}
+
−
{{#set: molecular weight=146.099    }}
+
−
{{#set: common name=(R)-2-methylmalic acid|(3R)-citramalate|(3R)-citramalic acid|(3R)-&alpha;-hydroxypyrotartaric acid|D-citramalate|D-citramalic acid|D-&alpha;-hydroxypyrotartaric acid|(R)-2-methylmalate|(R)-(-)-citramalic acid}}
+
−
{{#set: produced by=RXN-7743}}
+

Revision as of 18:48, 18 March 2018

Reaction RXN-15587

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 indoxyl[c] + 1 3'-phosphoadenylyl-sulfate[c] <=> 1 H+[c] + 1 adenosine 3',5'-bisphosphate[c] + 1 indoxyl sulfate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11521&oldid=26975"