Difference between revisions of "R01655"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1602 RXN-1602] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] == * smiles: ** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O * inchi key...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] == |
− | * | + | * smiles: |
− | ** | + | ** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M |
− | ** | + | * common name: |
+ | ** N-acetyl-4-O-acetylneuraminate | ||
+ | * molecular weight: | ||
+ | ** 350.302 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-13181]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244557 25244557] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29006 29006] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04015 C04015] | |
− | + | * HMDB : HMDB00796 | |
− | * | + | {{#set: smiles=CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M}} |
− | * | + | {{#set: common name=N-acetyl-4-O-acetylneuraminate}} |
− | + | {{#set: molecular weight=350.302 }} | |
− | + | {{#set: consumed by=RXN-13181}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:48, 18 March 2018
Contents
Metabolite CPD-414
- smiles:
- CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O
- inchi key:
- InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M
- common name:
- N-acetyl-4-O-acetylneuraminate
- molecular weight:
- 350.302
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O" cannot be used as a page name in this wiki.