Difference between revisions of "TransportSeed CARBON-DIOXIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=...")
(Created page with "Category:Gene == Gene Tiso_gene_7386 == * left end position: ** 595 * transcription direction: ** NEGATIVE * right end position: ** 5875 * centisome position: ** 5.2978363...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] ==
+
== Gene Tiso_gene_7386 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
+
** 595
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
+
** 5875
−
* molecular weight:
+
* centisome position:
−
** 519.151    
+
** 5.2978363    
 
* Synonym(s):
 
* Synonym(s):
−
** 3',8-cH2GTP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-8340]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-16030]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-16121]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-17730]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7782]]
 +
* [[TRIGLSYN-PWY]]
 +
* [[PWY-6453]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))}}
+
{{#set: left end position=595}}
−
{{#set: inchi key=InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
+
{{#set: right end position=5875}}
−
{{#set: molecular weight=519.151   }}
+
{{#set: centisome position=5.2978363   }}
−
{{#set: common name=3',8-cH2GTP}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN|PHOSPHATIDATE-PHOSPHATASE-RXN|RXN-16030|RXN-16121|RXN-17730}}
−
{{#set: produced by=RXN-8340}}
+
{{#set: pathway associated=PWY-7782|TRIGLSYN-PWY|PWY-6453}}

Revision as of 18:49, 18 March 2018

Gene Tiso_gene_7386

  • left end position:
    • 595
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5875
  • centisome position:
    • 5.2978363
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TransportSeed_CARBON-DIOXIDE&oldid=27087"