Difference between revisions of "3-oxo-dodecanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METBALT-RXN METBALT-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METBALT-RXN METBALT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/4.3.1 EC-4.3.1]
+
** InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
 +
* common name:
 +
** XLXG xyloglucan oligosaccharide
 +
* molecular weight:
 +
** 1225.073   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-12399]]
** 1 [[WATER]][c] '''+''' 1 [[O-SUCCINYL-L-HOMOSERINE]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[2-OXOBUTANOATE]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H2O[c] '''+''' 1 O-succinyl-L-homoserine[c] '''=>''' 1 succinate[c] '''+''' 1 H+[c] '''+''' 1 ammonium[c] '''+''' 1 2-oxobutanoate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_3732]]
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[esiliculosus]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[creinhardtii]]
+
*** [[esiliculosus]]
+
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R00999 R00999]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940192 52940192]
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
{{#set: ec number=EC-4.3.1}}
+
{{#set: inchi key=InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N}}
{{#set: gene associated=Tiso_gene_3732}}
+
{{#set: common name=XLXG xyloglucan oligosaccharide}}
{{#set: in pathway=}}
+
{{#set: molecular weight=1225.073    }}
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-12399}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=creinhardtii|esiliculosus|athaliana}}
+

Revision as of 18:49, 18 March 2018

Metabolite CPD-13377

  • smiles:
    • C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
  • inchi key:
    • InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
  • common name:
    • XLXG xyloglucan oligosaccharide
  • molecular weight:
    • 1225.073
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links