Difference between revisions of "CPDQT-29"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-tRNAs CYS-tRNAs] == * common name: ** a tRNAcys * Synonym(s): ** TRNA(CYS) == Reaction(s)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-tRNAs CYS-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
 +
* smiles:
 +
** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
 
* common name:
 
* common name:
** a tRNAcys
+
** carboxyphosphinopyruvate
 +
* molecular weight:
 +
** 193.029   
 
* Synonym(s):
 
* Synonym(s):
** TRNA(CYS)
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTEINE--TRNA-LIGASE-RXN]]
+
* [[RXN-10828]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16637]]
+
* [[RXN-10827]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a tRNAcys}}
+
* PUBCHEM:
{{#set: common name=TRNA(CYS)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
{{#set: consumed by=CYSTEINE--TRNA-LIGASE-RXN}}
+
{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
{{#set: produced by=RXN-16637}}
+
{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
 +
{{#set: common name=carboxyphosphinopyruvate}}
 +
{{#set: molecular weight=193.029    }}
 +
{{#set: consumed by=RXN-10828}}
 +
{{#set: produced by=RXN-10827}}

Revision as of 18:50, 18 March 2018

Metabolite CPD-11740

  • smiles:
    • C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
  • inchi key:
    • InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
  • common name:
    • carboxyphosphinopyruvate
  • molecular weight:
    • 193.029
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.