Difference between revisions of "P-AMINO-BENZOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14576 RXN-14576] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14576 RXN-14576] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L
+
 
* common name:
 
* common name:
−
** di-trans,octa-cis-undecaprenyl phosphate
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
* ec number:
−
** 845.279   
+
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** ditrans,polycis-undecaprenyl phosphate
 
−
** ditrans,octacis-undecaprenyl phosphate
 
−
** C55-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11347]]
+
* With identifiers:
−
* [[PHOSNACMURPENTATRANS-RXN]]
+
** 1 [[CPD-15436]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD0-1162]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 (5Z)-tetradecenoyl-CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 (2E,5Z)-tetradecenoyl-CoA[c] '''+''' 1 hydrogen peroxide[c]
−
* [[RXN-8975]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18566]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7291]], oleate β-oxidation (isomerase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7291 PWY-7291]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C17556 C17556]
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.3.6}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60392 60392]
+
{{#set: gene associated=Tiso_gene_18566}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY-7291}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245635 25245635]
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=di-trans,octa-cis-undecaprenyl phosphate}}
+
−
{{#set: molecular weight=845.279    }}
+
−
{{#set: common name=ditrans,polycis-undecaprenyl phosphate|ditrans,octacis-undecaprenyl phosphate|C55-P}}
+
−
{{#set: consumed by=RXN-11347|PHOSNACMURPENTATRANS-RXN}}
+
−
{{#set: consumed or produced by=RXN-8975}}
+

Revision as of 18:50, 18 March 2018

Reaction RXN-14576

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7291, oleate β-oxidation (isomerase-dependent, yeast): PWY-7291
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=P-AMINO-BENZOATE&oldid=27237"