Difference between revisions of "Tiso gene 19914"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_11329 == * Synonym(s): == Reactions associated == * 3.2.2.17-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_11329 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] ==
 +
* smiles:
 +
** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
 +
* inchi key:
 +
** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
 +
* common name:
 +
** XXXG xyloglucan oligosaccharide
 +
* molecular weight:
 +
** 1062.931   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.2.2.17-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-12400]]
== Pathways associated ==
+
* [[RXN-12399]]
 +
* [[RXN-12398]]
 +
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=3.2.2.17-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180]
 +
{{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}}
 +
{{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}}
 +
{{#set: common name=XXXG xyloglucan oligosaccharide}}
 +
{{#set: molecular weight=1062.931    }}
 +
{{#set: produced by=RXN-12400|RXN-12399|RXN-12398}}

Revision as of 18:50, 18 March 2018

Metabolite CPD-13375

  • smiles:
    • C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
  • inchi key:
    • InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
  • common name:
    • XXXG xyloglucan oligosaccharide
  • molecular weight:
    • 1062.931
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links