Difference between revisions of "RXN-16096"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MCDH MCDH] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-methylacyl-coa dehydrogenase, 2-Met...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MCDH MCDH] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-methylacyl-coa dehydrogenase, 2-Methylprop-2-enoyl-CoA forming |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1.0 [[FAD]][m] '''+''' 1.0 [[ISOBUTYRYL-COA]][m] '''=>''' 1.0 [[METHACRYLYL-COA]][m] '''+''' 1.0 [[FADH2]][m] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1.0 FAD[m] '''+''' 1.0 isobutanoyl-CoA[m] '''=>''' 1.0 methylacrylyl-CoA[m] '''+''' 1.0 FADH2[m] |
| − | * [[ | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_16113]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | * [[Tiso_gene_10643]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=2-methylacyl-coa dehydrogenase, 2-Methylprop-2-enoyl-CoA forming}} | |
| − | + | {{#set: gene associated=Tiso_gene_16113|Tiso_gene_10643}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:51, 18 March 2018
Contents
Reaction MCDH
- direction:
- LEFT-TO-RIGHT
- common name:
- 2-methylacyl-coa dehydrogenase, 2-Methylprop-2-enoyl-CoA forming
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 FAD[m] + 1.0 ISOBUTYRYL-COA[m] => 1.0 METHACRYLYL-COA[m] + 1.0 FADH2[m]
- With common name(s):
- 1.0 FAD[m] + 1.0 isobutanoyl-CoA[m] => 1.0 methylacrylyl-CoA[m] + 1.0 FADH2[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
