Difference between revisions of "RXN-14811"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == * smiles: ** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-555 RXN66-555] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-555 RXN66-555] ==
* smiles:
+
* direction:
** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F
+
** [http://enzyme.expasy.org/EC/6.3.2 EC-6.3.2]
* common name:
+
** sirohydrochlorin
+
* molecular weight:
+
** 854.779   
+
 
* Synonym(s):
 
* Synonym(s):
** Precorrin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[DIMETHUROPORDEHYDROG-RXN]]
+
** 1 [[4-P-PANTOTHENATE]][c] '''+''' 1 [[CYS]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (R)-4'-phosphopantothenate[c] '''+''' 1 L-cysteine[c] '''+''' 1 ATP[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 R-4'-phosphopantothenoyl-L-cysteine[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_15171]]
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways  ==
 +
* [[COA-PWY-1]], coenzyme A biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=COA-PWY-1 COA-PWY-1]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 65207-12-7
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-6.3.2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245154 25245154]
+
{{#set: gene associated=Tiso_gene_15171}}
* CHEBI:
+
{{#set: in pathway=COA-PWY-1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58351 58351]
+
{{#set: reconstruction category=orthology}}
* BIGG : scl
+
{{#set: reconstruction source=orthology-synechocystis}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C05778 C05778]
+
{{#set: smiles=CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))}}
+
{{#set: inchi key=InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F}}
+
{{#set: common name=sirohydrochlorin}}
+
{{#set: molecular weight=854.779    }}
+
{{#set: common name=Precorrin}}
+
{{#set: produced by=DIMETHUROPORDEHYDROG-RXN}}
+

Revision as of 18:51, 18 March 2018

Reaction RXN66-555

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • COA-PWY-1, coenzyme A biosynthesis II (mammalian): COA-PWY-1
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links