Difference between revisions of "RXN-6321"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == * smiles: ** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8730 RXN-8730] == * direction: ** LEFT-TO-RIGHT * common name: ** inositol_polyphosphate_5phosp...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8730 RXN-8730] ==
−
* smiles:
+
* direction:
−
** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J
+
 
* common name:
 
* common name:
−
** (E)-2-methylcrotonoyl-CoA
+
** inositol_polyphosphate_5phosphatase
−
* molecular weight:
+
* ec number:
−
** 845.604   
+
** [http://enzyme.expasy.org/EC/3.1.3.56 EC-3.1.3.56]
 
* Synonym(s):
 
* Synonym(s):
−
** methylcrotonyl-CoA
 
−
** trans-2-methylbut-2-enoyl-CoA
 
−
** 2-methylbut-2-enoyl-CoA
 
−
** tigloyl-CoA
 
−
** tiglyl-CoA
 
−
** 2-methyl-crotonyl-CoA
 
−
** (E)-2-methylbut-2-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[MCDH_2mb2coa]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-506]][c] '''=>''' 1 [[INOSITOL-1-3-4-TRIPHOSPHATE]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[TIGLYLCOA-HYDROXY-RXN]]
+
** 1 H2O[c] '''+''' 1 D-myo-inositol (1,3,4,5)-tetrakisphosphate[c] '''=>''' 1 D-myo-inositol (1,3,4)-trisphosphate[c] '''+''' 1 phosphate[c]
−
* [[RXN-14266]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_6030]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6364]], D-myo-inositol (1,3,4)-trisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6364 PWY-6364]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6247-62-7
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11392 11392]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266534 45266534]
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03430 R03430]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15478 15478]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=inositol_polyphosphate_5phosphatase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03345 C03345]
+
{{#set: ec number=EC-3.1.3.56}}
−
* HMDB : HMDB02054
+
{{#set: gene associated=Tiso_gene_6030}}
−
{{#set: smiles=CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-6364|PWY-6362}}
−
{{#set: inchi key=InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=(E)-2-methylcrotonoyl-CoA}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: molecular weight=845.604    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=methylcrotonyl-CoA|trans-2-methylbut-2-enoyl-CoA|2-methylbut-2-enoyl-CoA|tigloyl-CoA|tiglyl-CoA|2-methyl-crotonyl-CoA|(E)-2-methylbut-2-enoyl-CoA}}
+
−
{{#set: produced by=MCDH_2mb2coa}}
+
−
{{#set: consumed or produced by=TIGLYLCOA-HYDROXY-RXN|RXN-14266}}
+

Revision as of 18:51, 18 March 2018

Reaction RXN-8730

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • inositol_polyphosphate_5phosphatase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 D-myo-inositol (1,3,4,5)-tetrakisphosphate[c] => 1 D-myo-inositol (1,3,4)-trisphosphate[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6364, D-myo-inositol (1,3,4)-trisphosphate biosynthesis: PWY-6364
    • 3 reactions found over 3 reactions in the full pathway
  • PWY-6362, 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): PWY-6362
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-6321&oldid=27400"