Difference between revisions of "RXN66-579"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ARG-tRNAs Charged-ARG-tRNAs] == * common name: ** an L-arginyl-[tRNAarg] * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == |
| + | * smiles: | ||
| + | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** D-gluconate |
| + | * molecular weight: | ||
| + | ** 195.149 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** D-gluconic acid | ||
| + | ** dextronic acid | ||
| + | ** maltonic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLUCONOLACT-RXN]] |
| + | * [[RXN-17754]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 526-95-4 |
| − | {{#set: produced by= | + | * METABOLIGHTS : MTBLC18391 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419706 6419706] | ||
| + | * HMDB : HMDB00625 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00257 C00257] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4925340.html 4925340] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18391 18391] | ||
| + | * BIGG : glcn | ||
| + | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M}} | ||
| + | {{#set: common name=D-gluconate}} | ||
| + | {{#set: molecular weight=195.149 }} | ||
| + | {{#set: common name=D-gluconic acid|dextronic acid|maltonic acid}} | ||
| + | {{#set: produced by=GLUCONOLACT-RXN|RXN-17754}} | ||
Revision as of 18:52, 18 March 2018
Contents
Metabolite GLUCONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M
- common name:
- D-gluconate
- molecular weight:
- 195.149
- Synonym(s):
- D-gluconic acid
- dextronic acid
- maltonic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 526-95-4
- METABOLIGHTS : MTBLC18391
- PUBCHEM:
- HMDB : HMDB00625
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : glcn
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.
