Difference between revisions of "RXN1G-1050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == * smiles: ** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-409 CPD-409] == * common name: ** a 2-acylglycerol * Synonym(s): ** a 2-monoglyceride ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-409 CPD-409] ==
* smiles:
+
** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J
+
 
* common name:
 
* common name:
** 5-cis, 7-trans-tetradecadienoyl-CoA
+
** a 2-acylglycerol
* molecular weight:
+
** 969.83   
+
 
* Synonym(s):
 
* Synonym(s):
** 5Z, 7E-tetradecadienoyl-CoA
+
** a 2-monoglyceride
 +
** a 2-glyceride
 +
** a 2-MAG
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14796]]
+
* [[RXN-1603]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-1602]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-12383]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 2-acylglycerol}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659270 90659270]
+
{{#set: common name=a 2-monoglyceride|a 2-glyceride|a 2-MAG}}
{{#set: smiles=CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: consumed by=RXN-1603}}
{{#set: inchi key=InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J}}
+
{{#set: produced by=RXN-1602}}
{{#set: common name=5-cis, 7-trans-tetradecadienoyl-CoA}}
+
{{#set: reversible reaction associated=RXN-12383}}
{{#set: molecular weight=969.83    }}
+
{{#set: common name=5Z, 7E-tetradecadienoyl-CoA}}
+
{{#set: consumed by=RXN-14796}}
+

Revision as of 18:52, 18 March 2018

Metabolite CPD-409

  • common name:
    • a 2-acylglycerol
  • Synonym(s):
    • a 2-monoglyceride
    • a 2-glyceride
    • a 2-MAG

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links