Difference between revisions of "N-terminal-N-Ac-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hexadecenoyl-ACPs 2-Hexadecenoyl-ACPs] == * common name: ** a trans hexadecenoyl-[acp] * Syno...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hexadecenoyl-ACPs 2-Hexadecenoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
 +
* smiles:
 +
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
 +
* inchi key:
 +
** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
 
* common name:
 
* common name:
−
** a trans hexadecenoyl-[acp]
+
** tetraiodothyroacetate ether glucuronide
 +
* molecular weight:
 +
** 921.943   
 
* Synonym(s):
 
* Synonym(s):
−
** a trans hexadec-2-enoyl-[acyl-carrier protein]
+
** tetraiodothyroacetic acid ether glucuronide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-9663]]
 
−
* [[RXN-9542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[4.2.1.61-RXN]]
+
* [[RXN-10616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: common name=a trans hexadecenoyl-[acp]}}
+
* PUBCHEM:
−
{{#set: common name=a trans hexadec-2-enoyl-[acyl-carrier protein]}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237]
−
{{#set: consumed by=RXN-9663|RXN-9542}}
+
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}}
−
{{#set: produced by=4.2.1.61-RXN}}
+
{{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}}
 +
{{#set: common name=tetraiodothyroacetate ether glucuronide}}
 +
{{#set: molecular weight=921.943    }}
 +
{{#set: common name=tetraiodothyroacetic acid ether glucuronide}}
 +
{{#set: produced by=RXN-10616}}

Revision as of 18:52, 18 March 2018

Metabolite CPD-11409

  • smiles:
    • C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
  • inchi key:
    • InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
  • common name:
    • tetraiodothyroacetate ether glucuronide
  • molecular weight:
    • 921.943
  • Synonym(s):
    • tetraiodothyroacetic acid ether glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-terminal-N-Ac-L-cysteine&oldid=27444"