Difference between revisions of "Tiso gene 557"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8143 == * Synonym(s): == Reactions associated == * 2.4.1.223-RXN ** pantograph-esiliculosus == Pathways associated == * PWY-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17367 CPD-17367] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17367 CPD-17367] == |
| + | * smiles: | ||
| + | ** CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=JHXLRLHTJYMVBK-DHDHVEHBSA-J | ||
| + | * common name: | ||
| + | ** (3R)-hydroxy-adrenoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 1094.012 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (3R)-hydroxy-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA | ||
| + | ** (3R)--hydroxy-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-16112]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193769 72193769] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76415 76415] | ||
| + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=JHXLRLHTJYMVBK-DHDHVEHBSA-J}} | ||
| + | {{#set: common name=(3R)-hydroxy-adrenoyl-CoA}} | ||
| + | {{#set: molecular weight=1094.012 }} | ||
| + | {{#set: common name=(3R)-hydroxy-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA|(3R)--hydroxy-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA}} | ||
| + | {{#set: produced by=RXN-16112}} | ||
Revision as of 18:52, 18 March 2018
Contents
Metabolite CPD-17367
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=JHXLRLHTJYMVBK-DHDHVEHBSA-J
- common name:
- (3R)-hydroxy-adrenoyl-CoA
- molecular weight:
- 1094.012
- Synonym(s):
- (3R)-hydroxy-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA
- (3R)--hydroxy-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
