Difference between revisions of "5-KETO-4-DEOXY-D-GLUCARATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_777 == * left end position: ** 24009 * transcription direction: ** NEGATIVE * right end position: ** 26194 * centisome position: ** 83.5560...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L |
− | * | + | * common name: |
− | ** | + | ** α-D-glucose 6-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
+ | ** α-glucose 6-phosphate | ||
+ | ** α-D-glucose-6-P | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[UG6PGT]] |
− | + | * [[UG6PGTn]] | |
− | + | * [[G6PADHh]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[BFFS]] | |
− | + | * [[RXN-1685]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[PGIA]] | |
− | * [[ | + | * [[PGIAh]] |
− | + | * [[G6PI]] | |
− | + | * [[G6PA_pi_th]] | |
− | + | * [[RXN-6182]] | |
− | + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | |
− | * [[RXN- | + | * [[PGMTh]] |
− | + | * [[PGCM]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604864 21604864] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10239175.html 10239175] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58225 58225] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00668 C00668] | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L}} | ||
+ | {{#set: common name=α-D-glucose 6-phosphate}} | ||
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: common name=α-glucose 6-phosphate|α-D-glucose-6-P}} | ||
+ | {{#set: consumed by=UG6PGT|UG6PGTn|G6PADHh}} | ||
+ | {{#set: produced by=BFFS|RXN-1685}} | ||
+ | {{#set: reversible reaction associated=PGIA|PGIAh|G6PI|G6PA_pi_th|RXN-6182|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|PGMTh|PGCM}} |
Revision as of 18:52, 18 March 2018
Contents
Metabolite ALPHA-GLC-6-P
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
- common name:
- α-D-glucose 6-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- α-glucose 6-phosphate
- α-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.