Difference between revisions of "Tiso gene 507"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=QEFRNWWLZK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * smiles: ** C(C1(C(=CC=CC=1)N))(=O)[O-] * inchi key: ** InChIKey...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C1(C(=CC=CC=1)N))(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=RWZYAGGXGHYGMB-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** anthranilate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 136.13 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** anthranilic acid |
| + | ** 2-aminobenzoic acid | ||
| + | ** vitamin L1 | ||
| + | ** o-aminobenzoic acid | ||
| + | ** 2-aminobenzoate | ||
| + | ** o-aminobenzoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[KYNURENINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[PRTRANS-RXN]] | ||
| + | * [[ANTHRANSYN-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 118-92-3 | ||
| + | * METABOLIGHTS : MTBLC16567 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459842 5459842] |
| + | * HMDB : HMDB01123 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00108 C00108] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4573598.html 4573598] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16567 16567] |
| − | * BIGG : | + | * BIGG : anth |
| − | {{#set: smiles= | + | {{#set: smiles=C(C1(C(=CC=CC=1)N))(=O)[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=RWZYAGGXGHYGMB-UHFFFAOYSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=anthranilate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=136.13 }} |
| − | {{#set: common name= | + | {{#set: common name=anthranilic acid|2-aminobenzoic acid|vitamin L1|o-aminobenzoic acid|2-aminobenzoate|o-aminobenzoate}} |
| − | {{#set: | + | {{#set: produced by=KYNURENINASE-RXN}} |
| + | {{#set: reversible reaction associated=PRTRANS-RXN|ANTHRANSYN-RXN}} | ||
Revision as of 18:52, 18 March 2018
Contents
Metabolite ANTHRANILATE
- smiles:
- C(C1(C(=CC=CC=1)N))(=O)[O-]
- inchi key:
- InChIKey=RWZYAGGXGHYGMB-UHFFFAOYSA-M
- common name:
- anthranilate
- molecular weight:
- 136.13
- Synonym(s):
- anthranilic acid
- 2-aminobenzoic acid
- vitamin L1
- o-aminobenzoic acid
- 2-aminobenzoate
- o-aminobenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 118-92-3
- METABOLIGHTS : MTBLC16567
- PUBCHEM:
- HMDB : HMDB01123
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : anth
"C(C1(C(=CC=CC=1)N))(=O)[O-" cannot be used as a page name in this wiki.
