Difference between revisions of "Tiso gene 18652"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-PROLINE D-PROLINE] == * smiles: ** C1([N+]C(CC1)C(=O)[O-]) * inchi key: ** InChIKey=ONIBWKKTO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == * smiles: ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] * inchi key: ** InChI...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (R)-pantothenate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 218.229 |
* Synonym(s): | * Synonym(s): | ||
| + | ** vitamin B5 | ||
| + | ** (R)-pantothenic acid | ||
| + | ** D-pantothenic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PANTOTHENATE-KIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 79-83-4 |
| + | * Wikipedia : Vitamin_B5 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167945 167945] |
| − | * HMDB : | + | * HMDB : HMDB00210 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00864 C00864] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.146912.html 146912] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29032 29032] |
| − | * | + | * BIGG : pnto__R |
| − | {{#set: smiles= | + | {{#set: smiles=CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=(R)-pantothenate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=218.229 }} |
| − | {{#set: consumed | + | {{#set: common name=vitamin B5|(R)-pantothenic acid|D-pantothenic acid}} |
| + | {{#set: consumed by=PANTOTHENATE-KIN-RXN}} | ||
| + | {{#set: produced by=PANTOATE-BETA-ALANINE-LIG-RXN}} | ||
Revision as of 18:52, 18 March 2018
Contents
Metabolite PANTOTHENATE
- smiles:
- CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]
- inchi key:
- InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M
- common name:
- (R)-pantothenate
- molecular weight:
- 218.229
- Synonym(s):
- vitamin B5
- (R)-pantothenic acid
- D-pantothenic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 79-83-4
- Wikipedia : Vitamin_B5
- PUBCHEM:
- HMDB : HMDB00210
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : pnto__R
"CC(C)(CO)C(O)C(=O)NCCC(=O)[O-" cannot be used as a page name in this wiki.
