Difference between revisions of "Tiso gene 19373"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLARSONATE METHYLARSONATE] == * smiles: ** C[As](=O)([O-])O * inchi key: ** InChIKey=QYPPRT...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M |
* common name: | * common name: | ||
| − | ** | + | ** melibionate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 357.291 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** melibionic acid |
| + | ** 6-O-α-D-galactopyranosyl-D-gluconic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17754]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299] |
| − | + | {{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}} | |
| − | + | {{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}} | |
| − | + | {{#set: common name=melibionate}} | |
| − | {{#set: smiles=C | + | {{#set: molecular weight=357.291 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-17754}} |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Revision as of 18:53, 18 March 2018
Contents
Metabolite CPD-3801
- smiles:
- C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
- inchi key:
- InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
- common name:
- melibionate
- molecular weight:
- 357.291
- Synonym(s):
- melibionic acid
- 6-O-α-D-galactopyranosyl-D-gluconic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.
