Difference between revisions of "Tiso gene 8252"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE] == * smiles: ** C[N+](...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-hexanoyl-ACPs 3-oxo-hexanoyl-ACPs] == * common name: ** a 3-oxo-hexanoyl-[acp] * Synonym(...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-hexanoyl-ACPs 3-oxo-hexanoyl-ACPs] ==
−
* smiles:
+
−
** C[N+](CCCC(C(C([O-])=O)[N+])O)(C)C
+
−
* inchi key:
+
−
** InChIKey=ZRJHLGYVUCPZNH-MQWKRIRWSA-O
+
 
* common name:
 
* common name:
−
** 3-hydroxy-N6,N6,N6-trimethyl-L-lysine
+
** a 3-oxo-hexanoyl-[acp]
−
* molecular weight:
+
−
** 205.276   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (5-amino-5-carboxy-4-hydroxy-pentyl)-trimethyl-ammonium
+
** a 3-oxo-hexanoyl-[acyl-carrier protein]
−
** 3-hydroxy-N6,N6,N6-trimethyl-L-lysin-N6-ium
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-9896]]
+
* [[RXN-9518]]
 +
* [[RXN-14972]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9648]]
 +
* [[RXN-9516]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a 3-oxo-hexanoyl-[acp]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01259 C01259]
+
{{#set: common name=a 3-oxo-hexanoyl-[acyl-carrier protein]}}
−
* CHEBI:
+
{{#set: consumed by=RXN-9518|RXN-14972}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57515 57515]
+
{{#set: produced by=RXN-9648|RXN-9516}}
−
* METABOLIGHTS : MTBLC57515
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203146 25203146]
+
−
* HMDB : HMDB01422
+
−
{{#set: smiles=C[N+](CCCC(C(C([O-])=O)[N+])O)(C)C}}
+
−
{{#set: inchi key=InChIKey=ZRJHLGYVUCPZNH-MQWKRIRWSA-O}}
+
−
{{#set: common name=3-hydroxy-N6,N6,N6-trimethyl-L-lysine}}
+
−
{{#set: molecular weight=205.276    }}
+
−
{{#set: common name=(5-amino-5-carboxy-4-hydroxy-pentyl)-trimethyl-ammonium|3-hydroxy-N6,N6,N6-trimethyl-L-lysin-N6-ium}}
+
−
{{#set: consumed by=RXN-9896}}
+

Revision as of 18:53, 18 March 2018

Metabolite 3-oxo-hexanoyl-ACPs

  • common name:
    • a 3-oxo-hexanoyl-[acp]
  • Synonym(s):
    • a 3-oxo-hexanoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-hexanoyl-[acp" cannot be used as a page name in this wiki.
"a 3-oxo-hexanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8252&oldid=27581"