Difference between revisions of "CPD-5165"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15923 == * Synonym(s): == Reactions associated == * CATAL-RXN ** pantograph-synechocystis == Pathways associated == * PWY-55...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == |
+ | * smiles: | ||
+ | ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N | ||
+ | * common name: | ||
+ | ** 4-methylumbelliferyl glucoside | ||
+ | * molecular weight: | ||
+ | ** 338.313 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-MU-glucoside | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10769]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * DRUGBANK : DB02639 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2733779 2733779] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.2015550.html 2015550] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=91117 91117] | ||
+ | {{#set: smiles=CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))}} | ||
+ | {{#set: inchi key=InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N}} | ||
+ | {{#set: common name=4-methylumbelliferyl glucoside}} | ||
+ | {{#set: molecular weight=338.313 }} | ||
+ | {{#set: common name=4-MU-glucoside}} | ||
+ | {{#set: consumed by=RXN-10769}} |
Revision as of 19:53, 18 March 2018
Contents
Metabolite CPD-11641
- smiles:
- CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
- inchi key:
- InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
- common name:
- 4-methylumbelliferyl glucoside
- molecular weight:
- 338.313
- Synonym(s):
- 4-MU-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links