Difference between revisions of "HYDRPHENYLAC-CPD"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4015 == * Synonym(s): == Reactions associated == * NODOx ** pantograph-creinhardtii * NODOy ** pantograph-creinhardt...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == |
+ | * smiles: | ||
+ | ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** indoxyl sulfate | ||
+ | * molecular weight: | ||
+ | ** 212.2 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** indol-3-yl sulfate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | * [[RXN-15587]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: reaction associated= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355] | ||
+ | * HMDB : HMDB00682 | ||
+ | {{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}} | ||
+ | {{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=indoxyl sulfate}} | ||
+ | {{#set: molecular weight=212.2 }} | ||
+ | {{#set: common name=indol-3-yl sulfate}} | ||
+ | {{#set: reversible reaction associated=RXN-15587}} |
Revision as of 18:53, 18 March 2018
Contents
Metabolite CPD-16817
- smiles:
- C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
- inchi key:
- InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
- common name:
- indoxyl sulfate
- molecular weight:
- 212.2
- Synonym(s):
- indol-3-yl sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))" cannot be used as a page name in this wiki.