Difference between revisions of "HYDRPHENYLAC-CPD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4015 == * Synonym(s): == Reactions associated == * NODOx ** pantograph-creinhardtii * NODOy ** pantograph-creinhardt...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_4015 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] ==
 +
* smiles:
 +
** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
 +
* inchi key:
 +
** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
 +
* common name:
 +
** indoxyl sulfate
 +
* molecular weight:
 +
** 212.2   
 
* Synonym(s):
 
* Synonym(s):
 +
** indol-3-yl sulfate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[NODOx]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) of unknown directionality ==
* [[NODOy]]
+
* [[RXN-15587]]
** [[pantograph]]-[[creinhardtii]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=NODOx|NODOy}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355]
 +
* HMDB : HMDB00682
 +
{{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}}
 +
{{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}}
 +
{{#set: common name=indoxyl sulfate}}
 +
{{#set: molecular weight=212.2    }}
 +
{{#set: common name=indol-3-yl sulfate}}
 +
{{#set: reversible reaction associated=RXN-15587}}

Revision as of 18:53, 18 March 2018

Metabolite CPD-16817

  • smiles:
    • C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
  • inchi key:
    • InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
  • common name:
    • indoxyl sulfate
  • molecular weight:
    • 212.2
  • Synonym(s):
    • indol-3-yl sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))" cannot be used as a page name in this wiki.