Difference between revisions of "Tiso gene 1559"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.140-RXN 2.7.1.140-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.140-RXN 2.7.1.140-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.1.140 EC-2.7.1.140]
+
** InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
 +
* common name:
 +
** β-D-ribose 5-phosphate
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-ribofuranose 5-phosphate
 +
** 5-O-phosphono-β-D-ribofuranose
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15346]]
−
** 1 [[ATP]][c] '''+''' 1 [[CPD-505]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-1107]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-15345]]
−
** 1 ATP[c] '''+''' 1 D-myo-inositol (1,3,4,6)-tetrakisphosphate[c] '''=>''' 1 H+[c] '''+''' 1 D-myo-inositol 1,3,4,5,6-pentakisphosphate[c] '''+''' 1 ADP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6366]], D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6372]], 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6365]], D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6365 PWY-6365]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12717 12717]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140377 7140377]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03478 R03478]
+
** [http://www.chemspider.com/Chemical-Structure.394672.html 394672]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-2.7.1.140}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722]
−
{{#set: in pathway=PWY-6366|PWY-6372|PWY-6365|PWY-6362|PWY-6554}}
+
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=β-D-ribose 5-phosphate}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}}
 +
{{#set: consumed by=RXN-15346}}
 +
{{#set: produced by=RXN-15345}}

Revision as of 18:54, 18 March 2018

Metabolite CPD-16551

  • smiles:
    • C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
  • inchi key:
    • InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
  • common name:
    • β-D-ribose 5-phosphate
  • molecular weight:
    • 228.095
  • Synonym(s):
    • β-D-ribofuranose 5-phosphate
    • 5-O-phosphono-β-D-ribofuranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1559&oldid=27679"