Difference between revisions of "FORMALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == * smiles: ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) * inchi key...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M |
* common name: | * common name: | ||
| − | ** | + | ** L-dopachrome |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 192.151 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** indole-5,6-quinoneimine |
| + | ** dopachrome | ||
| + | ** 2-L-carboxy-2,3-dihydroindole-5,6-quinone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11403]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11369]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01693 C01693] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57509 57509] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC57509 |
| − | {{#set: inchi key=InChIKey= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173181 46173181] |
| − | {{#set: molecular weight= | + | * HMDB : HMDB01430 |
| − | {{#set: common name= | + | {{#set: smiles=C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))}} |
| − | {{#set: produced by=RXN- | + | {{#set: inchi key=InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M}} |
| + | {{#set: common name=L-dopachrome}} | ||
| + | {{#set: molecular weight=192.151 }} | ||
| + | {{#set: common name=indole-5,6-quinoneimine|dopachrome|2-L-carboxy-2,3-dihydroindole-5,6-quinone}} | ||
| + | {{#set: consumed by=RXN-11403}} | ||
| + | {{#set: produced by=RXN-11369}} | ||
Revision as of 18:54, 18 March 2018
Contents
Metabolite L-DOPACHROME
- smiles:
- C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))
- inchi key:
- InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M
- common name:
- L-dopachrome
- molecular weight:
- 192.151
- Synonym(s):
- indole-5,6-quinoneimine
- dopachrome
- 2-L-carboxy-2,3-dihydroindole-5,6-quinone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))" cannot be used as a page name in this wiki.
