Difference between revisions of "Tiso gene 12514"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATUD ATUD] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:UDP phosphotransferase * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I | ||
* common name: | * common name: | ||
− | ** | + | ** pimeloyl-CoA |
+ | * molecular weight: | ||
+ | ** 904.649 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-carboxyhexanoyl-CoA | ||
+ | ** pimelyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[7KAPSYN-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266589 45266589] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57360 57360] |
− | {{#set: | + | * BIGG : pmcoa |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01063 C01063] |
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I}} | ||
+ | {{#set: common name=pimeloyl-CoA}} | ||
+ | {{#set: molecular weight=904.649 }} | ||
+ | {{#set: common name=6-carboxyhexanoyl-CoA|pimelyl-CoA}} | ||
+ | {{#set: consumed by=7KAPSYN-RXN}} |
Revision as of 19:54, 18 March 2018
Contents
Metabolite CPD-558
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
- common name:
- pimeloyl-CoA
- molecular weight:
- 904.649
- Synonym(s):
- 6-carboxyhexanoyl-CoA
- pimelyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.