Difference between revisions of "FUMARATE-REDUCTASE-NADH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxy-cis-D9-hexaecenoyl-ACPs 3-hydroxy-cis-D9-hexaecenoyl-ACPs] == * common name: ** a (3R...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxy-cis-D9-hexaecenoyl-ACPs 3-hydroxy-cis-D9-hexaecenoyl-ACPs] ==
* smiles:
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
+
* inchi key:
+
** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
+
 
* common name:
 
* common name:
** biotinyl-5'-adenylate
+
** a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp]
* molecular weight:
+
** 572.509   
+
 
* Synonym(s):
 
* Synonym(s):
** biotinyl-5'-AMP
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10660]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-7192]]
+
* [[RXN-10659]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798]
+
{{#set: consumed by=RXN-10660}}
* CHEBI:
+
{{#set: produced by=RXN-10659}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921]
+
* HMDB : HMDB04220
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}}
+
{{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}}
+
{{#set: common name=biotinyl-5'-adenylate}}
+
{{#set: molecular weight=572.509    }}
+
{{#set: common name=biotinyl-5'-AMP}}
+
{{#set: produced by=RXN0-7192}}
+

Revision as of 18:54, 18 March 2018

Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs

  • common name:
    • a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp" cannot be used as a page name in this wiki.