Difference between revisions of "CD-2S-SP-Complex"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTOSINE CYTOSINE] == * smiles: ** C1(NC(=O)N=C(N)C=1) * inchi key: ** InChIKey=OPTASPLRGRRNAP-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == * smiles: ** CC1(=C(C2(=C(C=N1)COC2=O))O) * inchi key: ** InChIKey=HHPDVQLB...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC1(=C(C2(=C(C=N1)COC2=O))O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** 4-pyridoxolactone |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 165.148 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PYRIDOXAL-4-DEHYDROGENASE-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151228 151228] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.133287.html 133287] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16871 16871] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00971 C00971] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB03454 |
− | {{#set: common name= | + | {{#set: smiles=CC1(=C(C2(=C(C=N1)COC2=O))O)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N}} |
− | + | {{#set: common name=4-pyridoxolactone}} | |
− | {{#set: produced by= | + | {{#set: molecular weight=165.148 }} |
+ | {{#set: produced by=PYRIDOXAL-4-DEHYDROGENASE-RXN}} |
Revision as of 19:54, 18 March 2018
Contents
Metabolite CPD-375
- smiles:
- CC1(=C(C2(=C(C=N1)COC2=O))O)
- inchi key:
- InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N
- common name:
- 4-pyridoxolactone
- molecular weight:
- 165.148
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links