Difference between revisions of "2.7.1.140-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTUP DCTUP] == * direction: ** LEFT-TO-RIGHT * common name: ** dCTP:uridine 5'-phosphotransferase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == * smiles: ** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTUP DCTUP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J
 
* common name:
 
* common name:
−
** dCTP:uridine 5'-phosphotransferase
+
** (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA
 +
* molecular weight:
 +
** 1015.898   
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-3-hydroxy-16:1-Δ9-CoA
 +
** (S)-3-hydroxy-9-cis-hexadecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17790]]
−
** 1.0 [[URIDINE]][c] '''+''' 1.0 [[DCTP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[UMP]][c] '''+''' 1.0 [[DCDP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 uridine[c] '''+''' 1.0 dCTP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 UMP[c] '''+''' 1.0 dCDP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14474]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_20134]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: common name=dCTP:uridine 5'-phosphotransferase}}
+
{{#set: inchi key=InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J}}
−
{{#set: gene associated=Tiso_gene_14474|Tiso_gene_20134}}
+
{{#set: common name=(S)-3-hydroxy-(9Z)-hexadecenoyl-CoA}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=1015.898    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=(S)-3-hydroxy-16:1-Δ9-CoA|(S)-3-hydroxy-9-cis-hexadecenoyl-CoA}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-17790}}
−
{{#set: reconstruction source=creinhardtii}}
+

Revision as of 18:54, 18 March 2018

Metabolite CPD-19155

  • smiles:
    • CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J
  • common name:
    • (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA
  • molecular weight:
    • 1015.898
  • Synonym(s):
    • (S)-3-hydroxy-16:1-Δ9-CoA
    • (S)-3-hydroxy-9-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.7.1.140-RXN&oldid=27744"