Difference between revisions of "Tiso gene 15652"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8032 RXN-8032] == * direction: ** REVERSIBLE * common name: ** 3-ketopimelyl-CoA thiolase * ec...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-MANNAC UDP-MANNAC] == * smiles: ** CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8032 RXN-8032] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-MANNAC UDP-MANNAC] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)
 +
* inchi key:
 +
** InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L
 
* common name:
 
* common name:
−
** 3-ketopimelyl-CoA thiolase
+
** UDP-N-acetyl-α-D-mannosamine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
+
** 605.342   
 
* Synonym(s):
 
* Synonym(s):
 +
** uridine diphosphate N-acetylmannosamine
 +
** uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester
 +
** UDP-acetylmannosamine
 +
** UDP-ManNAc
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[3-OXOPIMELOYL-COA]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[GLUTARYL-COA]][c] '''+''' 1 [[ACETYL-COA]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[UDPGLCNACEPIM-RXN]]
−
** 1 3-oxopimeloyl-CoA[c] '''+''' 1 coenzyme A[c] '''<=>''' 1 glutaryl-CoA[c] '''+''' 1 acetyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7195]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[CENTBENZCOA-PWY]], benzoyl-CoA degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=CENTBENZCOA-PWY CENTBENZCOA-PWY]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7401]], crotonate fermentation (to acetate and cyclohexane carboxylate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7401 PWY-7401]
+
−
** '''5''' reactions found over '''17''' reactions in the full pathway
+
−
* [[P321-PWY]], benzoyl-CoA degradation III (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P321-PWY P321-PWY]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R05586 R05586]
+
** [http://www.genome.jp/dbget-bin/www_bget?C01170 C01170]
−
{{#set: direction=REVERSIBLE}}
+
* CHEBI:
−
{{#set: common name=3-ketopimelyl-CoA thiolase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68623 68623]
−
{{#set: ec number=EC-2.3.1}}
+
* BIGG : uacmam
−
{{#set: gene associated=Tiso_gene_7195}}
+
* PUBCHEM:
−
{{#set: in pathway=CENTBENZCOA-PWY|PWY-7401|P321-PWY}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245190 25245190]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB13112
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)}}
−
{{#set: reconstruction source=esiliculosus|athaliana}}
+
{{#set: inchi key=InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L}}
 +
{{#set: common name=UDP-N-acetyl-&alpha;-D-mannosamine}}
 +
{{#set: molecular weight=605.342    }}
 +
{{#set: common name=uridine diphosphate N-acetylmannosamine|uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-&alpha;-D-mannopyranosyl) ester|UDP-acetylmannosamine|UDP-ManNAc}}
 +
{{#set: reversible reaction associated=UDPGLCNACEPIM-RXN}}

Revision as of 18:54, 18 March 2018

Metabolite UDP-MANNAC

  • smiles:
    • CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)
  • inchi key:
    • InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L
  • common name:
    • UDP-N-acetyl-α-D-mannosamine
  • molecular weight:
    • 605.342
  • Synonym(s):
    • uridine diphosphate N-acetylmannosamine
    • uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester
    • UDP-acetylmannosamine
    • UDP-ManNAc

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15652&oldid=27747"