Difference between revisions of "TRANSENOYLCOARED-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-108 CPD-108] == * smiles: ** CC1(C=CC(=CC=1)O) * inchi key: ** InChIKey=IWDCLRJOBJJRNH-UHFF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIK...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 3-isopropyl-10-(methylthio)-2-oxodecanoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 274.331 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-18201]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-18200]] |
== External links == | == External links == | ||
| − | + | {{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L}} | |
| − | + | {{#set: common name=3-isopropyl-10-(methylthio)-2-oxodecanoate}} | |
| − | + | {{#set: molecular weight=274.331 }} | |
| − | + | {{#set: consumed by=RXN-18201}} | |
| − | + | {{#set: reversible reaction associated=RXN-18200}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: smiles= | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:54, 18 March 2018
Contents
Metabolite CPD-19487
- smiles:
- CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- inchi key:
- InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L
- common name:
- 3-isopropyl-10-(methylthio)-2-oxodecanoate
- molecular weight:
- 274.331
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
