Difference between revisions of "GLC-D-LACTONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-396 CPD-396] == * smiles: ** C[N+]1(=CC=CC(=C1)C(=O)N) * inchi key: ** InChIKey=LDHMAVIPBRS...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-THF-GLU-N FORMYL-THF-GLU-N] == * common name: ** an N10-formyl-tetrahydrofolate * Synony...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-THF-GLU-N FORMYL-THF-GLU-N] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an N10-formyl-tetrahydrofolate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]] | ||
| + | * [[FORMYLTHFGLUSYNTH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[FORMATETHFLIG-RXN]] |
| + | * [[FORMYLTHFGLUSYNTH-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GART-RXN]] | ||
| + | * [[AICARTRANSFORM-RXN]] | ||
| + | * [[METHENYLTHFCYCLOHYDRO-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an N10-formyl-tetrahydrofolate}} | |
| − | + | {{#set: consumed by=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN|FORMYLTHFGLUSYNTH-RXN}} | |
| − | + | {{#set: produced by=FORMATETHFLIG-RXN|FORMYLTHFGLUSYNTH-RXN}} | |
| − | + | {{#set: reversible reaction associated=GART-RXN|AICARTRANSFORM-RXN|METHENYLTHFCYCLOHYDRO-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 18:54, 18 March 2018
Contents
Metabolite FORMYL-THF-GLU-N
- common name:
- an N10-formyl-tetrahydrofolate
- Synonym(s):
